C15H16N4O3S — CID 7423841
1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 7423841) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 7423841 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-[3-(1,3-benzoxazol-2-ylsulfanyl)propyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)NCCCSc2nc3ccccc3o2)no1 |
| InChI | InChI=1S/C15H16N4O3S/c1-10-9-13(19-22-10)18-14(20)16-7-4-8-23-15-17-11-5-2-3-6-12(11)21-15/h2-3,5-6,9H,4,7-8H2,1H3,(H2,16,18,19,20) |
| InChIKey | KZGUBDPXZJNMGA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|