C20H23N5O — CID 74239290
8-[3-(oxan-4-yl)-5-[(2R)-pyrrolidin-2-yl]-1,2,4-triazol-1-yl]quinoline (PubChem CID 74239290) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 8-[3-(oxan-4-yl)-5-[(2R)-pyrrolidin-2-yl]-1,2,4-triazol-1-yl]quinoline.
| Compound Name | 8-[3-(oxan-4-yl)-5-[(2R)-pyrrolidin-2-yl]-1,2,4-triazol-1-yl]quinoline |
|---|---|
| PubChem CID | 74239290 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 8-[3-(oxan-4-yl)-5-[(2R)-pyrrolidin-2-yl]-1,2,4-triazol-1-yl]quinoline |
| SMILES | c1cnc2c(-n3nc(C4CCOCC4)nc3[C@H]3CCCN3)cccc2c1 |
| InChI | InChI=1S/C20H23N5O/c1-4-14-5-2-11-22-18(14)17(7-1)25-20(16-6-3-10-21-16)23-19(24-25)15-8-12-26-13-9-15/h1-2,4-5,7,11,15-16,21H,3,6,8-10,12-13H2/t16-/m1/s1 |
| InChIKey | WXUPTTPMSCTTSW-MRXNPFEDSA-N |
| XLogP | 3.13 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |