C17H27N3O3 — CID 74239484
(1-ethyl-5-methylpyrazol-4-yl)-(5-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone (PubChem CID 74239484) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is (1-ethyl-5-methylpyrazol-4-yl)-(5-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone.
| Compound Name | (1-ethyl-5-methylpyrazol-4-yl)-(5-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone |
|---|---|
| PubChem CID | 74239484 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (1-ethyl-5-methylpyrazol-4-yl)-(5-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone |
| SMILES | CCn1ncc(C(=O)N2CCC3(CC2)OCCCC3OC)c1C |
| InChI | InChI=1S/C17H27N3O3/c1-4-20-13(2)14(12-18-20)16(21)19-9-7-17(8-10-19)15(22-3)6-5-11-23-17/h12,15H,4-11H2,1-3H3 |
| InChIKey | YDEIQVFHJXEDMB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |