About 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea
1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea (PubChem CID 74239554) has the molecular formula C16H19N5O2
and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea |
| PubChem CID | 74239554 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea |
| SMILES | CC(C)n1cc(NC(=O)NC2CC(=O)Nc3ccccc32)cn1 |
| InChI | InChI=1S/C16H19N5O2/c1-10(2)21-9-11(8-17-21)18-16(23)20-14-7-15(22)19-13-6-4-3-5-12(13)14/h3-6,8-10,14H,7H2,1-2H3,(H,19,22)(H2,18,20,23) |
| InChIKey | WBAFWPDVWMPCFT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea?
The IUPAC name of 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea (CID 74239554) is 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea.
What is the SMILES notation for 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea?
The canonical SMILES for 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea is CC(C)n1cc(NC(=O)NC2CC(=O)Nc3ccccc32)cn1.
What is the InChIKey of 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea?
The InChIKey is WBAFWPDVWMPCFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5O2/c1-10(2)21-9-11(8-17-21)18-16(23)20-14-7-15(22)19-13-6-4-3-5-12(13)14/h3-6,8-10,14H,7H2,1-2H3,(H,19,22)(H2,18,20,23).
What are the key properties of 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea?
1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea has a molecular weight of 313.36 g/mol, XLogP of 2.67, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-oxo-3,4-dihydro-1H-quinolin-4-yl)-3-(1-propan-2-ylpyrazol-4-yl)urea is sourced from PubChem (CID 74239554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).