About 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide
7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 74239727) has the molecular formula C14H10FN3O3
and a molecular weight of 287.25 g/mol. Its IUPAC name is 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide |
| PubChem CID | 74239727 |
| Molecular Formula | C14H10FN3O3 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C(NCc1ccon1)c1cc(=O)[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C14H10FN3O3/c15-8-1-2-10-11(6-13(19)17-12(10)5-8)14(20)16-7-9-3-4-21-18-9/h1-6H,7H2,(H,16,20)(H,17,19) |
| InChIKey | KVWBAPCXBVPXIW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide?
The IUPAC name of 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide (CID 74239727) is 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide.
What is the SMILES notation for 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide?
The canonical SMILES for 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide is O=C(NCc1ccon1)c1cc(=O)[nH]c2cc(F)ccc12.
What is the InChIKey of 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide?
The InChIKey is KVWBAPCXBVPXIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FN3O3/c15-8-1-2-10-11(6-13(19)17-12(10)5-8)14(20)16-7-9-3-4-21-18-9/h1-6H,7H2,(H,16,20)(H,17,19).
What are the key properties of 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide?
7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide has a molecular weight of 287.25 g/mol, XLogP of 1.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-N-(1,2-oxazol-3-ylmethyl)-2-oxo-1H-quinoline-4-carboxamide is sourced from PubChem (CID 74239727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).