About 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid
2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid (PubChem CID 74240474) has the molecular formula C16H25N3O4
and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid |
| PubChem CID | 74240474 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1nc(C2CCOCC2)nc1[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C16H25N3O4/c20-13(21)10-19-16(14(22)11-4-2-1-3-5-11)17-15(18-19)12-6-8-23-9-7-12/h11-12,14,22H,1-10H2,(H,20,21)/t14-/m1/s1 |
| InChIKey | MRQNEAJZBDYFPZ-CQSZACIVSA-N |
| XLogP | 1.87 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid?
The IUPAC name of 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid (CID 74240474) is 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid.
What is the SMILES notation for 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid?
The canonical SMILES for 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid is O=C(O)Cn1nc(C2CCOCC2)nc1[C@H](O)C1CCCCC1.
What is the InChIKey of 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid?
The InChIKey is MRQNEAJZBDYFPZ-CQSZACIVSA-N. The full InChI is InChI=1S/C16H25N3O4/c20-13(21)10-19-16(14(22)11-4-2-1-3-5-11)17-15(18-19)12-6-8-23-9-7-12/h11-12,14,22H,1-10H2,(H,20,21)/t14-/m1/s1.
What are the key properties of 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid?
2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid has a molecular weight of 323.39 g/mol, XLogP of 1.87, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(R)-cyclohexyl(hydroxy)methyl]-3-(oxan-4-yl)-1,2,4-triazol-1-yl]acetic acid is sourced from PubChem (CID 74240474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).