C10H13N7O — CID 7424110
4-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbaldehyde (PubChem CID 7424110) has the molecular formula C10H13N7O and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbaldehyde.
| Compound Name | 4-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 7424110 |
| Molecular Formula | C10H13N7O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbaldehyde |
| SMILES | Cn1nnc2c(N3CCN(C=O)CC3)ncnc21 |
| InChI | InChI=1S/C10H13N7O/c1-15-9-8(13-14-15)10(12-6-11-9)17-4-2-16(7-18)3-5-17/h6-7H,2-5H2,1H3 |
| InChIKey | RFGHBQOLGFAILF-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|