About N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine
N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 7424121) has the molecular formula C9H14N6O
and a molecular weight of 222.25 g/mol. Its IUPAC name is N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 7424121 |
| Molecular Formula | C9H14N6O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | COCCCNc1ncnc2c1nnn2C |
| InChI | InChI=1S/C9H14N6O/c1-15-9-7(13-14-15)8(11-6-12-9)10-4-3-5-16-2/h6H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | QGAKMXHVEHPFAL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine (CID 7424121) is N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine is COCCCNc1ncnc2c1nnn2C.
What is the InChIKey of N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is QGAKMXHVEHPFAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N6O/c1-15-9-7(13-14-15)8(11-6-12-9)10-4-3-5-16-2/h6H,3-5H2,1-2H3,(H,10,11,12).
What are the key properties of N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine?
N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 222.25 g/mol, XLogP of 0.21, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-3-methyltriazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 7424121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).