C19H24N4O2 — CID 74241317
3-benzyl-4-[2-(3,4,5-trimethylpyrazol-1-yl)acetyl]piperazin-2-one (PubChem CID 74241317) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-benzyl-4-[2-(3,4,5-trimethylpyrazol-1-yl)acetyl]piperazin-2-one.
| Compound Name | 3-benzyl-4-[2-(3,4,5-trimethylpyrazol-1-yl)acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 74241317 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 3-benzyl-4-[2-(3,4,5-trimethylpyrazol-1-yl)acetyl]piperazin-2-one |
| SMILES | Cc1nn(CC(=O)N2CCNC(=O)C2Cc2ccccc2)c(C)c1C |
| InChI | InChI=1S/C19H24N4O2/c1-13-14(2)21-23(15(13)3)12-18(24)22-10-9-20-19(25)17(22)11-16-7-5-4-6-8-16/h4-8,17H,9-12H2,1-3H3,(H,20,25) |
| InChIKey | NYNCOUVGUBWXIJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |