About (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol
(3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol (PubChem CID 74241402) has the molecular formula C13H17F2NO2
and a molecular weight of 257.28 g/mol. Its IUPAC name is (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol.
Molecular Properties
| Compound Name | (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol |
| PubChem CID | 74241402 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol |
| SMILES | CCN(Cc1ccc(F)c(F)c1)[C@H]1COC[C@@H]1O |
| InChI | InChI=1S/C13H17F2NO2/c1-2-16(12-7-18-8-13(12)17)6-9-3-4-10(14)11(15)5-9/h3-5,12-13,17H,2,6-8H2,1H3/t12-,13-/m0/s1 |
| InChIKey | JXQXQSHWUOHTGN-STQMWFEESA-N |
| XLogP | 1.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol?
The IUPAC name of (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol (CID 74241402) is (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol.
What is the SMILES notation for (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol?
The canonical SMILES for (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol is CCN(Cc1ccc(F)c(F)c1)[C@H]1COC[C@@H]1O.
What is the InChIKey of (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol?
The InChIKey is JXQXQSHWUOHTGN-STQMWFEESA-N. The full InChI is InChI=1S/C13H17F2NO2/c1-2-16(12-7-18-8-13(12)17)6-9-3-4-10(14)11(15)5-9/h3-5,12-13,17H,2,6-8H2,1H3/t12-,13-/m0/s1.
What are the key properties of (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol?
(3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol has a molecular weight of 257.28 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-[(3,4-difluorophenyl)methyl-ethylamino]oxolan-3-ol is sourced from PubChem (CID 74241402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).