C19H29N3 — CID 74241417
1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-(imidazol-1-ylmethyl)piperidine (PubChem CID 74241417) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-(imidazol-1-ylmethyl)piperidine.
| Compound Name | 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-(imidazol-1-ylmethyl)piperidine |
|---|---|
| PubChem CID | 74241417 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-(imidazol-1-ylmethyl)piperidine |
| SMILES | CC1(C)[C@H]2CC=C(CN3CCC(Cn4ccnc4)CC3)[C@@H]1C2 |
| InChI | InChI=1S/C19H29N3/c1-19(2)17-4-3-16(18(19)11-17)13-21-8-5-15(6-9-21)12-22-10-7-20-14-22/h3,7,10,14-15,17-18H,4-6,8-9,11-13H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | PQLKCFUVNPCOFO-ROUUACIJSA-N |
| XLogP | 3.59 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|