About 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid
1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid (PubChem CID 74241833) has the molecular formula C16H23N5O4
and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid |
| PubChem CID | 74241833 |
| Molecular Formula | C16H23N5O4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid |
| SMILES | Cc1nccc(N2CCN(C(=O)N3CCOCC3)CC(C(=O)O)C2)n1 |
| InChI | InChI=1S/C16H23N5O4/c1-12-17-3-2-14(18-12)20-4-5-21(11-13(10-20)15(22)23)16(24)19-6-8-25-9-7-19/h2-3,13H,4-11H2,1H3,(H,22,23) |
| InChIKey | UHVVGJWIRCULGY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid?
The IUPAC name of 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid (CID 74241833) is 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid.
What is the SMILES notation for 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid?
The canonical SMILES for 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid is Cc1nccc(N2CCN(C(=O)N3CCOCC3)CC(C(=O)O)C2)n1.
What is the InChIKey of 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid?
The InChIKey is UHVVGJWIRCULGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O4/c1-12-17-3-2-14(18-12)20-4-5-21(11-13(10-20)15(22)23)16(24)19-6-8-25-9-7-19/h2-3,13H,4-11H2,1H3,(H,22,23).
What are the key properties of 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid?
1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid has a molecular weight of 349.39 g/mol, XLogP of 0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpyrimidin-4-yl)-4-(morpholine-4-carbonyl)-1,4-diazepane-6-carboxylic acid is sourced from PubChem (CID 74241833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).