About 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone
1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone (PubChem CID 74242354) has the molecular formula C14H19N3O4
and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone |
| PubChem CID | 74242354 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2ncoc2C2CC2)CC(O)C1 |
| InChI | InChI=1S/C14H19N3O4/c1-9(18)16-4-5-17(7-11(19)6-16)14(20)12-13(10-2-3-10)21-8-15-12/h8,10-11,19H,2-7H2,1H3 |
| InChIKey | FGCDOSLQPDJPJQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone?
The IUPAC name of 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone (CID 74242354) is 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone.
What is the SMILES notation for 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone?
The canonical SMILES for 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone is CC(=O)N1CCN(C(=O)c2ncoc2C2CC2)CC(O)C1.
What is the InChIKey of 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone?
The InChIKey is FGCDOSLQPDJPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O4/c1-9(18)16-4-5-17(7-11(19)6-16)14(20)12-13(10-2-3-10)21-8-15-12/h8,10-11,19H,2-7H2,1H3.
What are the key properties of 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone?
1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone has a molecular weight of 293.32 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5-cyclopropyl-1,3-oxazole-4-carbonyl)-6-hydroxy-1,4-diazepan-1-yl]ethanone is sourced from PubChem (CID 74242354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).