C18H23ClN6O — CID 7424261
N-(3-chloro-4-methoxyphenyl)-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 7424261) has the molecular formula C18H23ClN6O and a molecular weight of 374.88 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 7424261 |
| Molecular Formula | C18H23ClN6O |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(Nc2nc(N3CCCC3)nc(N3CCCC3)n2)cc1Cl |
| InChI | InChI=1S/C18H23ClN6O/c1-26-15-7-6-13(12-14(15)19)20-16-21-17(24-8-2-3-9-24)23-18(22-16)25-10-4-5-11-25/h6-7,12H,2-5,8-11H2,1H3,(H,20,21,22,23) |
| InChIKey | QWTIAMPSOFNROL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |