About 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid
2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid (PubChem CID 74242739) has the molecular formula C18H21N3O5
and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid |
| PubChem CID | 74242739 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid |
| SMILES | CN(Cc1cc(-c2ncccn2)ccc1OCC(=O)O)[C@H]1COC[C@@H]1O |
| InChI | InChI=1S/C18H21N3O5/c1-21(14-9-25-10-15(14)22)8-13-7-12(18-19-5-2-6-20-18)3-4-16(13)26-11-17(23)24/h2-7,14-15,22H,8-11H2,1H3,(H,23,24)/t14-,15-/m0/s1 |
| InChIKey | OMRLXYUGUWUDGI-GJZGRUSLSA-N |
| XLogP | 0.80 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid?
The IUPAC name of 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid (CID 74242739) is 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid.
What is the SMILES notation for 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid?
The canonical SMILES for 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid is CN(Cc1cc(-c2ncccn2)ccc1OCC(=O)O)[C@H]1COC[C@@H]1O.
What is the InChIKey of 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid?
The InChIKey is OMRLXYUGUWUDGI-GJZGRUSLSA-N. The full InChI is InChI=1S/C18H21N3O5/c1-21(14-9-25-10-15(14)22)8-13-7-12(18-19-5-2-6-20-18)3-4-16(13)26-11-17(23)24/h2-7,14-15,22H,8-11H2,1H3,(H,23,24)/t14-,15-/m0/s1.
What are the key properties of 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid?
2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid has a molecular weight of 359.38 g/mol, XLogP of 0.80, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[[(3S,4R)-4-hydroxyoxolan-3-yl]-methylamino]methyl]-4-pyrimidin-2-ylphenoxy]acetic acid is sourced from PubChem (CID 74242739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).