About 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol
8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol (PubChem CID 74242939) has the molecular formula C12H18N2O2S
and a molecular weight of 254.35 g/mol. Its IUPAC name is 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol.
Molecular Properties
| Compound Name | 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol |
| PubChem CID | 74242939 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol |
| SMILES | OC1COC2(CCN(Cc3nccs3)CC2)C1 |
| InChI | InChI=1S/C12H18N2O2S/c15-10-7-12(16-9-10)1-4-14(5-2-12)8-11-13-3-6-17-11/h3,6,10,15H,1-2,4-5,7-9H2 |
| InChIKey | TXFLMJIIZYZWLK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol?
The IUPAC name of 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol (CID 74242939) is 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol.
What is the SMILES notation for 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol?
The canonical SMILES for 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol is OC1COC2(CCN(Cc3nccs3)CC2)C1.
What is the InChIKey of 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol?
The InChIKey is TXFLMJIIZYZWLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2S/c15-10-7-12(16-9-10)1-4-14(5-2-12)8-11-13-3-6-17-11/h3,6,10,15H,1-2,4-5,7-9H2.
What are the key properties of 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol?
8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol has a molecular weight of 254.35 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,3-thiazol-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decan-3-ol is sourced from PubChem (CID 74242939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).