C17H25N5OS — CID 74243492
2-(dimethylamino)-8-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 74243492) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is 2-(dimethylamino)-8-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 2-(dimethylamino)-8-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 74243492 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-(dimethylamino)-8-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CN(C)C1=NC2(CCN(Cc3nc4c(s3)CCCC4)CC2)C(=O)N1 |
| InChI | InChI=1S/C17H25N5OS/c1-21(2)16-19-15(23)17(20-16)7-9-22(10-8-17)11-14-18-12-5-3-4-6-13(12)24-14/h3-11H2,1-2H3,(H,19,20,23) |
| InChIKey | XIXGWZNREBTBAZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |