C18H22N4O3 — CID 74244774
8-methoxy-N-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 74244774) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 8-methoxy-N-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | 8-methoxy-N-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 74244774 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 8-methoxy-N-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | COc1cccc2c1OCC(C(=O)NCc1cc3n(n1)CCNC3)C2 |
| InChI | InChI=1S/C18H22N4O3/c1-24-16-4-2-3-12-7-13(11-25-17(12)16)18(23)20-9-14-8-15-10-19-5-6-22(15)21-14/h2-4,8,13,19H,5-7,9-11H2,1H3,(H,20,23) |
| InChIKey | LOASPCMOVOMVMS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |