C16H22FNO2 — CID 74244914
N-[2-(3-fluorophenyl)ethyl]-2,2-dimethyloxane-4-carboxamide (PubChem CID 74244914) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]-2,2-dimethyloxane-4-carboxamide.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]-2,2-dimethyloxane-4-carboxamide |
|---|---|
| PubChem CID | 74244914 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]-2,2-dimethyloxane-4-carboxamide |
| SMILES | CC1(C)CC(C(=O)NCCc2cccc(F)c2)CCO1 |
| InChI | InChI=1S/C16H22FNO2/c1-16(2)11-13(7-9-20-16)15(19)18-8-6-12-4-3-5-14(17)10-12/h3-5,10,13H,6-9,11H2,1-2H3,(H,18,19) |
| InChIKey | PEVFFDKDMGHGQO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |