About 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole
5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole (PubChem CID 74245660) has the molecular formula C16H24ClN3S
and a molecular weight of 325.91 g/mol. Its IUPAC name is 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole |
| PubChem CID | 74245660 |
| Molecular Formula | C16H24ClN3S |
| Molecular Weight | 325.91 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole |
| SMILES | Clc1nc(N2CCCC2)sc1CN1C[C@@H]2CCC[C@H](C2)C1 |
| InChI | InChI=1S/C16H24ClN3S/c17-15-14(21-16(18-15)20-6-1-2-7-20)11-19-9-12-4-3-5-13(8-12)10-19/h12-13H,1-11H2/t12-,13-/m1/s1 |
| InChIKey | OKVINBIJFBNKMU-CHWSQXEVSA-N |
| XLogP | 4.02 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.91 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole?
The IUPAC name of 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole (CID 74245660) is 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole.
What is the SMILES notation for 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole?
The canonical SMILES for 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole is Clc1nc(N2CCCC2)sc1CN1C[C@@H]2CCC[C@H](C2)C1.
What is the InChIKey of 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole?
The InChIKey is OKVINBIJFBNKMU-CHWSQXEVSA-N. The full InChI is InChI=1S/C16H24ClN3S/c17-15-14(21-16(18-15)20-6-1-2-7-20)11-19-9-12-4-3-5-13(8-12)10-19/h12-13H,1-11H2/t12-,13-/m1/s1.
What are the key properties of 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole?
5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole has a molecular weight of 325.91 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1R,5R)-3-azabicyclo[3.3.1]nonan-3-yl]methyl]-4-chloro-2-pyrrolidin-1-yl-1,3-thiazole is sourced from PubChem (CID 74245660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).