About 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline
6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline (PubChem CID 74247744) has the molecular formula C18H21ClN2O
and a molecular weight of 316.83 g/mol. Its IUPAC name is 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline.
Molecular Properties
| Compound Name | 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline |
| PubChem CID | 74247744 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline |
| SMILES | COC1[C@@H]2CC[C@H]1CN(Cc1ccc3cc(Cl)ccc3n1)C2 |
| InChI | InChI=1S/C18H21ClN2O/c1-22-18-13-2-3-14(18)10-21(9-13)11-16-6-4-12-8-15(19)5-7-17(12)20-16/h4-8,13-14,18H,2-3,9-11H2,1H3/t13-,14+,18? |
| InChIKey | AJPREOYUOUIFLW-UUVAVEHKSA-N |
| XLogP | 3.74 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline?
The IUPAC name of 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline (CID 74247744) is 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline.
What is the SMILES notation for 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline?
The canonical SMILES for 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline is COC1[C@@H]2CC[C@H]1CN(Cc1ccc3cc(Cl)ccc3n1)C2.
What is the InChIKey of 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline?
The InChIKey is AJPREOYUOUIFLW-UUVAVEHKSA-N. The full InChI is InChI=1S/C18H21ClN2O/c1-22-18-13-2-3-14(18)10-21(9-13)11-16-6-4-12-8-15(19)5-7-17(12)20-16/h4-8,13-14,18H,2-3,9-11H2,1H3/t13-,14+,18?.
What are the key properties of 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline?
6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline has a molecular weight of 316.83 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]quinoline is sourced from PubChem (CID 74247744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).