About N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide
N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide (PubChem CID 74247941) has the molecular formula C18H17N5O3
and a molecular weight of 351.37 g/mol. Its IUPAC name is N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide |
| PubChem CID | 74247941 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide |
| SMILES | CN(Cc1ccc2nonc2c1)C(=O)c1ccc2c(c1)ncn2CCO |
| InChI | InChI=1S/C18H17N5O3/c1-22(10-12-2-4-14-15(8-12)21-26-20-14)18(25)13-3-5-17-16(9-13)19-11-23(17)6-7-24/h2-5,8-9,11,24H,6-7,10H2,1H3 |
| InChIKey | LBIOWLLCTJLLQF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide?
The IUPAC name of N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide (CID 74247941) is N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide.
What is the SMILES notation for N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide?
The canonical SMILES for N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide is CN(Cc1ccc2nonc2c1)C(=O)c1ccc2c(c1)ncn2CCO.
What is the InChIKey of N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide?
The InChIKey is LBIOWLLCTJLLQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O3/c1-22(10-12-2-4-14-15(8-12)21-26-20-14)18(25)13-3-5-17-16(9-13)19-11-23(17)6-7-24/h2-5,8-9,11,24H,6-7,10H2,1H3.
What are the key properties of N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide?
N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide has a molecular weight of 351.37 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,1,3-benzoxadiazol-5-ylmethyl)-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide is sourced from PubChem (CID 74247941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).