C15H14ClN3O5S — CID 7424813
ethyl 2-[4-chloro-5-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]acetate (PubChem CID 7424813) has the molecular formula C15H14ClN3O5S and a molecular weight of 383.81 g/mol. Its IUPAC name is ethyl 2-[4-chloro-5-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]acetate.
| Compound Name | ethyl 2-[4-chloro-5-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]acetate |
|---|---|
| PubChem CID | 7424813 |
| Molecular Formula | C15H14ClN3O5S |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | ethyl 2-[4-chloro-5-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1c(Cl)c(/C=N\NC(=O)c2ccccc2O)sc1=O |
| InChI | InChI=1S/C15H14ClN3O5S/c1-2-24-12(21)8-19-13(16)11(25-15(19)23)7-17-18-14(22)9-5-3-4-6-10(9)20/h3-7,20H,2,8H2,1H3,(H,18,22)/b17-7- |
| InChIKey | IEKAGKPKDRGJQO-IDUWFGFVSA-N |
| XLogP | 1.60 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|