C19H23FN2O2 — CID 74248512
N-[1-(4-fluorophenyl)propyl]-1-methyl-2-oxo-6-propan-2-ylpyridine-3-carboxamide (PubChem CID 74248512) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)propyl]-1-methyl-2-oxo-6-propan-2-ylpyridine-3-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)propyl]-1-methyl-2-oxo-6-propan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 74248512 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-[1-(4-fluorophenyl)propyl]-1-methyl-2-oxo-6-propan-2-ylpyridine-3-carboxamide |
| SMILES | CCC(NC(=O)c1ccc(C(C)C)n(C)c1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FN2O2/c1-5-16(13-6-8-14(20)9-7-13)21-18(23)15-10-11-17(12(2)3)22(4)19(15)24/h6-12,16H,5H2,1-4H3,(H,21,23) |
| InChIKey | WICJPQHENNVYTM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |