About (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol
(3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol (PubChem CID 74250206) has the molecular formula C14H28N2O3S
and a molecular weight of 304.46 g/mol. Its IUPAC name is (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol.
Molecular Properties
| Compound Name | (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol |
| PubChem CID | 74250206 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol |
| SMILES | CCCCS(=O)(=O)N1CCC2(CCNCC2CO)CC1 |
| InChI | InChI=1S/C14H28N2O3S/c1-2-3-10-20(18,19)16-8-5-14(6-9-16)4-7-15-11-13(14)12-17/h13,15,17H,2-12H2,1H3 |
| InChIKey | DJSPHCHMQBOXLA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol?
The IUPAC name of (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol (CID 74250206) is (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol.
What is the SMILES notation for (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol?
The canonical SMILES for (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol is CCCCS(=O)(=O)N1CCC2(CCNCC2CO)CC1.
What is the InChIKey of (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol?
The InChIKey is DJSPHCHMQBOXLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O3S/c1-2-3-10-20(18,19)16-8-5-14(6-9-16)4-7-15-11-13(14)12-17/h13,15,17H,2-12H2,1H3.
What are the key properties of (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol?
(3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol has a molecular weight of 304.46 g/mol, XLogP of 0.80, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butylsulfonyl-3,9-diazaspiro[5.5]undecan-11-yl)methanol is sourced from PubChem (CID 74250206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).