C17H19ClN6O — CID 74250549
4-chloro-N-(3-imidazol-1-ylpropyl)-1-methyl-N-(pyridin-4-ylmethyl)pyrazole-3-carboxamide (PubChem CID 74250549) has the molecular formula C17H19ClN6O and a molecular weight of 358.83 g/mol. Its IUPAC name is 4-chloro-N-(3-imidazol-1-ylpropyl)-1-methyl-N-(pyridin-4-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-(3-imidazol-1-ylpropyl)-1-methyl-N-(pyridin-4-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 74250549 |
| Molecular Formula | C17H19ClN6O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 4-chloro-N-(3-imidazol-1-ylpropyl)-1-methyl-N-(pyridin-4-ylmethyl)pyrazole-3-carboxamide |
| SMILES | Cn1cc(Cl)c(C(=O)N(CCCn2ccnc2)Cc2ccncc2)n1 |
| InChI | InChI=1S/C17H19ClN6O/c1-22-12-15(18)16(21-22)17(25)24(11-14-3-5-19-6-4-14)9-2-8-23-10-7-20-13-23/h3-7,10,12-13H,2,8-9,11H2,1H3 |
| InChIKey | IPGGJQIEOZBDFN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |