About (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone
(2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 74251163) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone.
Molecular Properties
| Compound Name | (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone |
| PubChem CID | 74251163 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | CCCCC1C=CCN1C(=O)c1cc(-c2ccc(OC)cc2)n[nH]1 |
| InChI | InChI=1S/C19H23N3O2/c1-3-4-6-15-7-5-12-22(15)19(23)18-13-17(20-21-18)14-8-10-16(24-2)11-9-14/h5,7-11,13,15H,3-4,6,12H2,1-2H3,(H,20,21) |
| InChIKey | ZOSJNNWXQBDUJJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone?
The IUPAC name of (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone (CID 74251163) is (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone.
What is the SMILES notation for (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone?
The canonical SMILES for (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone is CCCCC1C=CCN1C(=O)c1cc(-c2ccc(OC)cc2)n[nH]1.
What is the InChIKey of (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone?
The InChIKey is ZOSJNNWXQBDUJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-3-4-6-15-7-5-12-22(15)19(23)18-13-17(20-21-18)14-8-10-16(24-2)11-9-14/h5,7-11,13,15H,3-4,6,12H2,1-2H3,(H,20,21).
What are the key properties of (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone?
(2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone has a molecular weight of 325.41 g/mol, XLogP of 3.66, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butyl-2,5-dihydropyrrol-1-yl)-[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methanone is sourced from PubChem (CID 74251163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).