About [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium
[5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium (PubChem CID 7425172) has the molecular formula C13H14Cl2NO2+
and a molecular weight of 287.17 g/mol. Its IUPAC name is [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium.
Molecular Properties
| Compound Name | [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium |
| PubChem CID | 7425172 |
| Molecular Formula | C13H14Cl2NO2+ |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium |
| SMILES | OCC[NH2+]Cc1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C13H13Cl2NO2/c14-10-5-9(6-11(15)7-10)13-2-1-12(18-13)8-16-3-4-17/h1-2,5-7,16-17H,3-4,8H2/p+1 |
| InChIKey | BCNIROLOCVZMEX-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 49.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium?
The IUPAC name of [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium (CID 7425172) is [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium.
What is the SMILES notation for [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium?
The canonical SMILES for [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium is OCC[NH2+]Cc1ccc(-c2cc(Cl)cc(Cl)c2)o1.
What is the InChIKey of [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium?
The InChIKey is BCNIROLOCVZMEX-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H13Cl2NO2/c14-10-5-9(6-11(15)7-10)13-2-1-12(18-13)8-16-3-4-17/h1-2,5-7,16-17H,3-4,8H2/p+1.
What are the key properties of [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium?
[5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium has a molecular weight of 287.17 g/mol, XLogP of 2.31, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,5-dichlorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium is sourced from PubChem (CID 7425172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).