C20H26NOS+ — CID 742557
3-ethyl-5-methoxy-2-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzothiazol-3-ium (PubChem CID 742557) has the molecular formula C20H26NOS+ and a molecular weight of 328.50 g/mol. Its IUPAC name is 3-ethyl-5-methoxy-2-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-ethyl-5-methoxy-2-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 742557 |
| Molecular Formula | C20H26NOS+ |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 3-ethyl-5-methoxy-2-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(/C=C2/C=C(C)CC(C)(C)C2)sc2ccc(OC)cc21 |
| InChI | InChI=1S/C20H26NOS/c1-6-21-17-11-16(22-5)7-8-18(17)23-19(21)10-15-9-14(2)12-20(3,4)13-15/h7-11H,6,12-13H2,1-5H3/q+1/b15-10- |
| InChIKey | BCVRTIZCYCYQRZ-GDNBJRDFSA-N |
| XLogP | 5.37 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|