About [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+)
[2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+) (PubChem CID 74257205) has the molecular formula C9H18N2O3Pt+2
and a molecular weight of 397.33 g/mol. Its IUPAC name is [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+).
Molecular Properties
| Compound Name | [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+) |
| PubChem CID | 74257205 |
| Molecular Formula | C9H18N2O3Pt+2 |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+) |
| SMILES | CC([O-])C(=O)[O-].NCC1CCC1CN.[Pt+4] |
| InChI | InChI=1S/C6H14N2.C3H5O3.Pt/c7-3-5-1-2-6(5)4-8;1-2(4)3(5)6;/h5-6H,1-4,7-8H2;2H,1H3,(H,5,6);/q;-1;+4/p-1 |
| InChIKey | XSMVECZRZBFTIZ-UHFFFAOYSA-M |
| XLogP | -2.59 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+)?
The IUPAC name of [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+) (CID 74257205) is [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+).
What is the SMILES notation for [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+)?
The canonical SMILES for [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+) is CC([O-])C(=O)[O-].NCC1CCC1CN.[Pt+4].
What is the InChIKey of [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+)?
The InChIKey is XSMVECZRZBFTIZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14N2.C3H5O3.Pt/c7-3-5-1-2-6(5)4-8;1-2(4)3(5)6;/h5-6H,1-4,7-8H2;2H,1H3,(H,5,6);/q;-1;+4/p-1.
What are the key properties of [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+)?
[2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+) has a molecular weight of 397.33 g/mol, XLogP of -2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+) is sourced from PubChem (CID 74257205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).