About [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate
[4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate (PubChem CID 742609) has the molecular formula C13H12N2O4
and a molecular weight of 260.25 g/mol. Its IUPAC name is [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate |
| PubChem CID | 742609 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C13H12N2O4/c1-8-7-12(15-19-8)14-13(17)10-3-5-11(6-4-10)18-9(2)16/h3-7H,1-2H3,(H,14,15,17) |
| InChIKey | VALLCEDZSXCGCU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate?
The IUPAC name of [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate (CID 742609) is [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate.
What is the SMILES notation for [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate?
The canonical SMILES for [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate is CC(=O)Oc1ccc(C(=O)Nc2cc(C)on2)cc1.
What is the InChIKey of [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate?
The InChIKey is VALLCEDZSXCGCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O4/c1-8-7-12(15-19-8)14-13(17)10-3-5-11(6-4-10)18-9(2)16/h3-7H,1-2H3,(H,14,15,17).
What are the key properties of [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate?
[4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate has a molecular weight of 260.25 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]phenyl] acetate is sourced from PubChem (CID 742609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).