C5H5N3O3 — CID 7426990
5-methanimidoyl-1,3-diazinane-2,4,6-trione (PubChem CID 7426990) has the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. Its IUPAC name is 5-methanimidoyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-methanimidoyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7426990 |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 5-methanimidoyl-1,3-diazinane-2,4,6-trione |
| SMILES | [H]/N=C/C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C5H5N3O3/c6-1-2-3(9)7-5(11)8-4(2)10/h1-2,6H,(H2,7,8,9,10,11)/b6-1+ |
| InChIKey | SLJOCEPWEUJGHO-LZCJLJQNSA-N |
| XLogP | -1.38 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|