C9H18N4S — CID 7427347
[(Z)-[(2S,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino]thiourea (PubChem CID 7427347) has the molecular formula C9H18N4S and a molecular weight of 214.34 g/mol. Its IUPAC name is [(Z)-[(2S,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino]thiourea.
| Compound Name | [(Z)-[(2S,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 7427347 |
| Molecular Formula | C9H18N4S |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | [(Z)-[(2S,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino]thiourea |
| SMILES | C[C@@H]1CN(C)[C@@H](C)C/C1=N/NC(N)=S |
| InChI | InChI=1S/C9H18N4S/c1-6-5-13(3)7(2)4-8(6)11-12-9(10)14/h6-7H,4-5H2,1-3H3,(H3,10,12,14)/b11-8-/t6-,7+/m1/s1 |
| InChIKey | YAOJGOYGZHFMHH-PMSDMECNSA-N |
| XLogP | 0.54 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|