C18H27NO4 — CID 7429084
(1R,4aS,8aS)-1-(2,4,5-trimethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-4a-ol (PubChem CID 7429084) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (1R,4aS,8aS)-1-(2,4,5-trimethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-4a-ol.
| Compound Name | (1R,4aS,8aS)-1-(2,4,5-trimethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-4a-ol |
|---|---|
| PubChem CID | 7429084 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (1R,4aS,8aS)-1-(2,4,5-trimethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-4a-ol |
| SMILES | COc1cc(OC)c([C@@H]2NCC[C@@]3(O)CCCC[C@@H]23)cc1OC |
| InChI | InChI=1S/C18H27NO4/c1-21-14-11-16(23-3)15(22-2)10-12(14)17-13-6-4-5-7-18(13,20)8-9-19-17/h10-11,13,17,19-20H,4-9H2,1-3H3/t13-,17-,18-/m0/s1 |
| InChIKey | SDRFMWNQZYYVQM-KKXDTOCCSA-N |
| XLogP | 2.67 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |