C25H29N2O3+ — CID 7429172
diethyl-[2-[(2R)-4-hydroxy-5-oxo-2-phenyl-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]ethyl]azanium (PubChem CID 7429172) has the molecular formula C25H29N2O3+ and a molecular weight of 405.52 g/mol. Its IUPAC name is diethyl-[2-[(2R)-4-hydroxy-5-oxo-2-phenyl-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[(2R)-4-hydroxy-5-oxo-2-phenyl-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7429172 |
| Molecular Formula | C25H29N2O3+ |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | diethyl-[2-[(2R)-4-hydroxy-5-oxo-2-phenyl-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]ethyl]azanium |
| SMILES | CC[NH+](CC)CCN1C(=O)C(O)=C(C(=O)/C=C/c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H28N2O3/c1-3-26(4-2)17-18-27-23(20-13-9-6-10-14-20)22(24(29)25(27)30)21(28)16-15-19-11-7-5-8-12-19/h5-16,23,29H,3-4,17-18H2,1-2H3/p+1/b16-15+/t23-/m1/s1 |
| InChIKey | RZMYPCSNEHEULF-POICXBNUSA-O |
| XLogP | 2.59 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|