C18H18Cl2FN3O2 — CID 74292237
N-[1-(4-amino-3,5-dichloroanilino)-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide (PubChem CID 74292237) has the molecular formula C18H18Cl2FN3O2 and a molecular weight of 398.27 g/mol. Its IUPAC name is N-[1-(4-amino-3,5-dichloroanilino)-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[1-(4-amino-3,5-dichloroanilino)-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 74292237 |
| Molecular Formula | C18H18Cl2FN3O2 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[1-(4-amino-3,5-dichloroanilino)-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(F)cc1)C(=O)Nc1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2FN3O2/c1-9(2)16(24-17(25)10-3-5-11(21)6-4-10)18(26)23-12-7-13(19)15(22)14(20)8-12/h3-9,16H,22H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | DKDQISSBKHVXDX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|