C21H21NO4 — CID 7430163
(5S)-3-(1,3-benzodioxol-5-ylmethylimino)-5-(4-methoxyphenyl)cyclohexan-1-one (PubChem CID 7430163) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (5S)-3-(1,3-benzodioxol-5-ylmethylimino)-5-(4-methoxyphenyl)cyclohexan-1-one.
| Compound Name | (5S)-3-(1,3-benzodioxol-5-ylmethylimino)-5-(4-methoxyphenyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 7430163 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (5S)-3-(1,3-benzodioxol-5-ylmethylimino)-5-(4-methoxyphenyl)cyclohexan-1-one |
| SMILES | COc1ccc([C@@H]2CC(=O)C/C(=N\Cc3ccc4c(c3)OCO4)C2)cc1 |
| InChI | InChI=1S/C21H21NO4/c1-24-19-5-3-15(4-6-19)16-9-17(11-18(23)10-16)22-12-14-2-7-20-21(8-14)26-13-25-20/h2-8,16H,9-13H2,1H3/b22-17-/t16-/m0/s1 |
| InChIKey | MXHFXIYUIVAWJF-UDWOFDDZSA-N |
| XLogP | 3.90 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|