C18H15N3O7 — CID 7431252
(4S)-2-amino-4-(4,5-dimethoxy-2-nitrophenyl)-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-3-carbonitrile (PubChem CID 7431252) has the molecular formula C18H15N3O7 and a molecular weight of 385.33 g/mol. Its IUPAC name is (4S)-2-amino-4-(4,5-dimethoxy-2-nitrophenyl)-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(4,5-dimethoxy-2-nitrophenyl)-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-3-carbonitrile |
|---|---|
| PubChem CID | 7431252 |
| Molecular Formula | C18H15N3O7 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | (4S)-2-amino-4-(4,5-dimethoxy-2-nitrophenyl)-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-3-carbonitrile |
| SMILES | COc1cc([C@H]2C(C#N)=C(N)Oc3cc(C)oc(=O)c32)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H15N3O7/c1-8-4-14-16(18(22)27-8)15(10(7-19)17(20)28-14)9-5-12(25-2)13(26-3)6-11(9)21(23)24/h4-6,15H,20H2,1-3H3/t15-/m0/s1 |
| InChIKey | OZSHAXIQHBQOPU-HNNXBMFYSA-N |
| XLogP | 2.09 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|