About [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea
[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea (PubChem CID 7431321) has the molecular formula C5H8N2O3S
and a molecular weight of 176.20 g/mol. Its IUPAC name is [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea.
Molecular Properties
| Compound Name | [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea |
| PubChem CID | 7431321 |
| Molecular Formula | C5H8N2O3S |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea |
| SMILES | NC(=O)N[C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C5H8N2O3S/c6-5(8)7-4-1-2-11(9,10)3-4/h1-2,4H,3H2,(H3,6,7,8)/t4-/m1/s1 |
| InChIKey | UIRLIGWMUSLUAD-SCSAIBSYSA-N |
| XLogP | -1.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea?
The IUPAC name of [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea (CID 7431321) is [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea.
What is the SMILES notation for [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea?
The canonical SMILES for [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea is NC(=O)N[C@@H]1C=CS(=O)(=O)C1.
What is the InChIKey of [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea?
The InChIKey is UIRLIGWMUSLUAD-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H8N2O3S/c6-5(8)7-4-1-2-11(9,10)3-4/h1-2,4H,3H2,(H3,6,7,8)/t4-/m1/s1.
What are the key properties of [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea?
[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea has a molecular weight of 176.20 g/mol, XLogP of -1.03, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]urea is sourced from PubChem (CID 7431321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).