C12H12N2S2 — CID 74315241
5-(3-phenylprop-2-enylsulfanyl)-1,3-thiazol-2-amine (PubChem CID 74315241) has the molecular formula C12H12N2S2 and a molecular weight of 248.38 g/mol. Its IUPAC name is 5-(3-phenylprop-2-enylsulfanyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(3-phenylprop-2-enylsulfanyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 74315241 |
| Molecular Formula | C12H12N2S2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-(3-phenylprop-2-enylsulfanyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(SCC=Cc2ccccc2)s1 |
| InChI | InChI=1S/C12H12N2S2/c13-12-14-9-11(16-12)15-8-4-7-10-5-2-1-3-6-10/h1-7,9H,8H2,(H2,13,14) |
| InChIKey | WFGVUBHRQKGDTM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |