About 5,7-dichloro-2,7-dihydroindazol-3-one
5,7-dichloro-2,7-dihydroindazol-3-one (PubChem CID 74316074) has the molecular formula C7H4Cl2N2O
and a molecular weight of 203.03 g/mol. Its IUPAC name is 5,7-dichloro-2,7-dihydroindazol-3-one.
Molecular Properties
| Compound Name | 5,7-dichloro-2,7-dihydroindazol-3-one |
| PubChem CID | 74316074 |
| Molecular Formula | C7H4Cl2N2O |
| Molecular Weight | 203.03 g/mol |
| Exact Mass | 201.97 |
| IUPAC Name | 5,7-dichloro-2,7-dihydroindazol-3-one |
| SMILES | O=C1NN=C2C1=CC(Cl)=CC2Cl |
| InChI | InChI=1S/C7H4Cl2N2O/c8-3-1-4-6(5(9)2-3)10-11-7(4)12/h1-2,5H,(H,11,12) |
| InChIKey | VQBWULKNQISGNR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.03 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-2,7-dihydroindazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-2,7-dihydroindazol-3-one?
The IUPAC name of 5,7-dichloro-2,7-dihydroindazol-3-one (CID 74316074) is 5,7-dichloro-2,7-dihydroindazol-3-one.
What is the SMILES notation for 5,7-dichloro-2,7-dihydroindazol-3-one?
The canonical SMILES for 5,7-dichloro-2,7-dihydroindazol-3-one is O=C1NN=C2C1=CC(Cl)=CC2Cl.
What is the InChIKey of 5,7-dichloro-2,7-dihydroindazol-3-one?
The InChIKey is VQBWULKNQISGNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2N2O/c8-3-1-4-6(5(9)2-3)10-11-7(4)12/h1-2,5H,(H,11,12).
What are the key properties of 5,7-dichloro-2,7-dihydroindazol-3-one?
5,7-dichloro-2,7-dihydroindazol-3-one has a molecular weight of 203.03 g/mol, XLogP of 1.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-2,7-dihydroindazol-3-one is sourced from PubChem (CID 74316074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).