C21H19N3O2S — CID 7431675
(4R)-5-cyano-N-(2-methoxyphenyl)-2-methyl-4-phenyl-6-sulfanyl-3,4-dihydropyridine-3-carboxamide (PubChem CID 7431675) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is (4R)-5-cyano-N-(2-methoxyphenyl)-2-methyl-4-phenyl-6-sulfanyl-3,4-dihydropyridine-3-carboxamide.
| Compound Name | (4R)-5-cyano-N-(2-methoxyphenyl)-2-methyl-4-phenyl-6-sulfanyl-3,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 7431675 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (4R)-5-cyano-N-(2-methoxyphenyl)-2-methyl-4-phenyl-6-sulfanyl-3,4-dihydropyridine-3-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1C(C)=NC(S)=C(C#N)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H19N3O2S/c1-13-18(20(25)24-16-10-6-7-11-17(16)26-2)19(14-8-4-3-5-9-14)15(12-22)21(27)23-13/h3-11,18-19,27H,1-2H3,(H,24,25)/t18?,19-/m1/s1 |
| InChIKey | CWWBQYAECBUXHU-MUMRKEEXSA-N |
| XLogP | 4.17 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|