C12H11NOS2 — CID 74317047
1-(2-sulfanylidene-4,8b-dihydro-3aH-indeno[1,2-d][1,3]thiazol-1-yl)ethanone (PubChem CID 74317047) has the molecular formula C12H11NOS2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(2-sulfanylidene-4,8b-dihydro-3aH-indeno[1,2-d][1,3]thiazol-1-yl)ethanone.
| Compound Name | 1-(2-sulfanylidene-4,8b-dihydro-3aH-indeno[1,2-d][1,3]thiazol-1-yl)ethanone |
|---|---|
| PubChem CID | 74317047 |
| Molecular Formula | C12H11NOS2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 1-(2-sulfanylidene-4,8b-dihydro-3aH-indeno[1,2-d][1,3]thiazol-1-yl)ethanone |
| SMILES | CC(=O)N1C(=S)SC2Cc3ccccc3C21 |
| InChI | InChI=1S/C12H11NOS2/c1-7(14)13-11-9-5-3-2-4-8(9)6-10(11)16-12(13)15/h2-5,10-11H,6H2,1H3 |
| InChIKey | SRMDZENTJVRNHA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|