About methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate
methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate (PubChem CID 74317174) has the molecular formula C14H26N2O5
and a molecular weight of 302.37 g/mol. Its IUPAC name is methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate.
Molecular Properties
| Compound Name | methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate |
| PubChem CID | 74317174 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate |
| SMILES | COC(=O)C(CCC(N)=O)NCCC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C14H26N2O5/c1-14(2)8-20-12(21-9-14)6-7-16-10(13(18)19-3)4-5-11(15)17/h10,12,16H,4-9H2,1-3H3,(H2,15,17) |
| InChIKey | RIDVWMNUMBIFPD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate?
The IUPAC name of methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate (CID 74317174) is methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate.
What is the SMILES notation for methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate?
The canonical SMILES for methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate is COC(=O)C(CCC(N)=O)NCCC1OCC(C)(C)CO1.
What is the InChIKey of methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate?
The InChIKey is RIDVWMNUMBIFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O5/c1-14(2)8-20-12(21-9-14)6-7-16-10(13(18)19-3)4-5-11(15)17/h10,12,16H,4-9H2,1-3H3,(H2,15,17).
What are the key properties of methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate?
methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate has a molecular weight of 302.37 g/mol, XLogP of 0.17, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-5-oxopentanoate is sourced from PubChem (CID 74317174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).