C32H56O5 — CID 74319112
(2,22,23-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraen-3-yl) acetate (PubChem CID 74319112) has the molecular formula C32H56O5 and a molecular weight of 520.80 g/mol. Its IUPAC name is (2,22,23-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraen-3-yl) acetate.
| Compound Name | (2,22,23-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraen-3-yl) acetate |
|---|---|
| PubChem CID | 74319112 |
| Molecular Formula | C32H56O5 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.41 |
| IUPAC Name | (2,22,23-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18-tetraen-3-yl) acetate |
| SMILES | CC(=O)OC(CCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC(O)C(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C32H56O5/c1-24(16-12-18-26(3)20-22-29(34)31(6,7)35)14-10-11-15-25(2)17-13-19-27(4)21-23-30(32(8,9)36)37-28(5)33/h14-15,18-19,29-30,34-36H,10-13,16-17,20-23H2,1-9H3 |
| InChIKey | BKHZEULGRLICQT-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|