About [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate (PubChem CID 7431952) has the molecular formula C19H28O2
and a molecular weight of 288.43 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate.
Molecular Properties
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate |
| PubChem CID | 7431952 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H28O2/c1-14(2)17-11-9-15(3)13-18(17)21-19(20)12-10-16-7-5-4-6-8-16/h4-8,14-15,17-18H,9-13H2,1-3H3/t15-,17+,18-/m1/s1 |
| InChIKey | JXILMICIUDORQR-BPQIPLTHSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate?
The IUPAC name of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate (CID 7431952) is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate.
What is the SMILES notation for [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate?
The canonical SMILES for [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate is CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)CCc1ccccc1.
What is the InChIKey of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate?
The InChIKey is JXILMICIUDORQR-BPQIPLTHSA-N. The full InChI is InChI=1S/C19H28O2/c1-14(2)17-11-9-15(3)13-18(17)21-19(20)12-10-16-7-5-4-6-8-16/h4-8,14-15,17-18H,9-13H2,1-3H3/t15-,17+,18-/m1/s1.
What are the key properties of [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate?
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate has a molecular weight of 288.43 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-phenylpropanoate is sourced from PubChem (CID 7431952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).