About 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide
2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide (PubChem CID 74319750) has the molecular formula C11H10F3NO
and a molecular weight of 229.20 g/mol. Its IUPAC name is 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide.
Molecular Properties
| Compound Name | 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide |
| PubChem CID | 74319750 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide |
| SMILES | Cc1cc(C=CC(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C11H10F3NO/c1-7-6-8(4-5-11(12,13)14)2-3-9(7)10(15)16/h2-6H,1H3,(H2,15,16) |
| InChIKey | RDMOBOPIMBATJS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide?
The IUPAC name of 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide (CID 74319750) is 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide.
What is the SMILES notation for 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide?
The canonical SMILES for 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide is Cc1cc(C=CC(F)(F)F)ccc1C(N)=O.
What is the InChIKey of 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide?
The InChIKey is RDMOBOPIMBATJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO/c1-7-6-8(4-5-11(12,13)14)2-3-9(7)10(15)16/h2-6H,1H3,(H2,15,16).
What are the key properties of 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide?
2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide has a molecular weight of 229.20 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(3,3,3-trifluoroprop-1-enyl)benzamide is sourced from PubChem (CID 74319750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).