About 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid
3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid (PubChem CID 743198) has the molecular formula C7H7IN2O4
and a molecular weight of 310.05 g/mol. Its IUPAC name is 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid |
| PubChem CID | 743198 |
| Molecular Formula | C7H7IN2O4 |
| Molecular Weight | 310.05 g/mol |
| Exact Mass | 309.95 |
| IUPAC Name | 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid |
| SMILES | O=C(O)CCn1cc(I)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H7IN2O4/c8-4-3-10(2-1-5(11)12)7(14)9-6(4)13/h3H,1-2H2,(H,11,12)(H,9,13,14) |
| InChIKey | MPDRMLZJDIQAOH-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.05 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid?
The IUPAC name of 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid (CID 743198) is 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid.
What is the SMILES notation for 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid?
The canonical SMILES for 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid is O=C(O)CCn1cc(I)c(=O)[nH]c1=O.
What is the InChIKey of 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid?
The InChIKey is MPDRMLZJDIQAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7IN2O4/c8-4-3-10(2-1-5(11)12)7(14)9-6(4)13/h3H,1-2H2,(H,11,12)(H,9,13,14).
What are the key properties of 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid?
3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid has a molecular weight of 310.05 g/mol, XLogP of -0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-iodo-2,4-dioxopyrimidin-1-yl)propanoic acid is sourced from PubChem (CID 743198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).