About 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid
2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid (PubChem CID 743202) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid |
| PubChem CID | 743202 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CC(=O)O |
| InChI | InChI=1S/C7H8N2O4/c1-3-4(2-5(10)11)6(12)9-7(13)8-3/h2H2,1H3,(H,10,11)(H2,8,9,12,13) |
| InChIKey | GFWWREGOTNQVGC-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid?
The IUPAC name of 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid (CID 743202) is 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid.
What is the SMILES notation for 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid?
The canonical SMILES for 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid is Cc1[nH]c(=O)[nH]c(=O)c1CC(=O)O.
What is the InChIKey of 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid?
The InChIKey is GFWWREGOTNQVGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-3-4(2-5(10)11)6(12)9-7(13)8-3/h2H2,1H3,(H,10,11)(H2,8,9,12,13).
What are the key properties of 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid?
2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid has a molecular weight of 184.15 g/mol, XLogP of -1.00, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetic acid is sourced from PubChem (CID 743202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).