About 2-(3-methylhexyl)-1,3-dioxolane
2-(3-methylhexyl)-1,3-dioxolane (PubChem CID 74325321) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-(3-methylhexyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(3-methylhexyl)-1,3-dioxolane |
| PubChem CID | 74325321 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 2-(3-methylhexyl)-1,3-dioxolane |
| SMILES | CCCC(C)CCC1OCCO1 |
| InChI | InChI=1S/C10H20O2/c1-3-4-9(2)5-6-10-11-7-8-12-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | PXVYLUDBAKCLES-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methylhexyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylhexyl)-1,3-dioxolane?
The IUPAC name of 2-(3-methylhexyl)-1,3-dioxolane (CID 74325321) is 2-(3-methylhexyl)-1,3-dioxolane.
What is the SMILES notation for 2-(3-methylhexyl)-1,3-dioxolane?
The canonical SMILES for 2-(3-methylhexyl)-1,3-dioxolane is CCCC(C)CCC1OCCO1.
What is the InChIKey of 2-(3-methylhexyl)-1,3-dioxolane?
The InChIKey is PXVYLUDBAKCLES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-3-4-9(2)5-6-10-11-7-8-12-10/h9-10H,3-8H2,1-2H3.
What are the key properties of 2-(3-methylhexyl)-1,3-dioxolane?
2-(3-methylhexyl)-1,3-dioxolane has a molecular weight of 172.27 g/mol, XLogP of 2.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylhexyl)-1,3-dioxolane is sourced from PubChem (CID 74325321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).